CymitQuimica logo

CAS 886500-62-5

:

N1-Cyclohexyl-N2-(1-methylpropyl)-1,2-ethanediamine

Description:
N1-Cyclohexyl-N2-(1-methylpropyl)-1,2-ethanediamine, with the CAS number 886500-62-5, is an organic compound characterized by its amine functional groups. This substance features a cyclohexyl group and a branched alkyl chain, which contribute to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of two amine groups allows for potential hydrogen bonding, influencing its solubility in polar solvents. This compound may exhibit basicity due to the amine functionalities, making it reactive in various chemical reactions, including nucleophilic substitutions. Its structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed, as with all amines, due to potential toxicity and reactivity. Overall, N1-Cyclohexyl-N2-(1-methylpropyl)-1,2-ethanediamine is a versatile compound with interesting chemical behavior suitable for further research and application in various fields.
Formula:C12H26N2
InChI:InChI=1S/C12H26N2/c1-3-11(2)13-9-10-14-12-7-5-4-6-8-12/h11-14H,3-10H2,1-2H3
InChI key:InChIKey=NVZOBRQHIZYAPZ-UHFFFAOYSA-N
SMILES:N(CCNC(CC)C)C1CCCCC1
Synonyms:
  • N1-Cyclohexyl-N2-(1-methylpropyl)-1,2-ethanediamine
  • 1,2-Ethanediamine, N-cyclohexyl-N′-(1-methylpropyl)-
  • 1,2-Ethanediamine, N1-cyclohexyl-N2-(1-methylpropyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.