
CAS 886500-68-1
:2-[(3,4-Dihydro-6-methyl-4-oxo-3-phenyl-2-quinazolinyl)thio]acetic acid
Description:
2-[(3,4-Dihydro-6-methyl-4-oxo-3-phenyl-2-quinazolinyl)thio]acetic acid, with the CAS number 886500-68-1, is a chemical compound characterized by its unique quinazoline structure, which contributes to its potential biological activity. This compound features a thioether linkage, indicating the presence of a sulfur atom bonded to the carbon chain, which can influence its reactivity and solubility. The presence of a phenyl group enhances its aromatic characteristics, while the acetic acid moiety suggests potential for acidic behavior and interactions with biological systems. The compound's structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be influenced by the functional groups present. Overall, this compound represents a class of heterocyclic compounds that may exhibit diverse biological activities, warranting further investigation for potential therapeutic applications.
Formula:C17H14N2O3S
InChI:InChI=1S/C17H14N2O3S/c1-11-7-8-14-13(9-11)16(22)19(12-5-3-2-4-6-12)17(18-14)23-10-15(20)21/h2-9H,10H2,1H3,(H,20,21)
InChI key:InChIKey=IVFWXZXYUWNGCS-UHFFFAOYSA-N
SMILES:S(CC(O)=O)C=1N(C(=O)C=2C(N1)=CC=C(C)C2)C3=CC=CC=C3
Synonyms:- 2-[(3,4-Dihydro-6-methyl-4-oxo-3-phenyl-2-quinazolinyl)thio]acetic acid
- Acetic acid, 2-[(3,4-dihydro-6-methyl-4-oxo-3-phenyl-2-quinazolinyl)thio]-
- Acetic acid, [(3,4-dihydro-6-methyl-4-oxo-3-phenyl-2-quinazolinyl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.