CymitQuimica logo

CAS 886500-86-3

:

2-[(3,4-Dihydro-6,7-dimethoxy-3-methyl-4-oxo-2-quinazolinyl)thio]acetic acid

Description:
2-[(3,4-Dihydro-6,7-dimethoxy-3-methyl-4-oxo-2-quinazolinyl)thio]acetic acid, with the CAS number 886500-86-3, is a chemical compound characterized by its unique quinazoline structure, which includes a thioether linkage and an acetic acid functional group. This compound typically exhibits properties associated with both the quinazoline and thioether classes, such as potential biological activity, including antimicrobial or anticancer effects, due to the presence of the quinazoline moiety. The methoxy groups contribute to its lipophilicity, potentially enhancing its ability to penetrate biological membranes. The presence of the thioether group may also influence its reactivity and interaction with biological targets. As a synthetic compound, it may be of interest in medicinal chemistry for the development of new therapeutic agents. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it essential to consider these factors in practical applications.
Formula:C13H14N2O5S
InChI:InChI=1S/C13H14N2O5S/c1-15-12(18)7-4-9(19-2)10(20-3)5-8(7)14-13(15)21-6-11(16)17/h4-5H,6H2,1-3H3,(H,16,17)
InChI key:InChIKey=UMEJKWPTKXERPJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(N=C(SCC(O)=O)N1C)=CC(OC)=C(OC)C2
Synonyms:
  • 2-[(3,4-Dihydro-6,7-dimethoxy-3-methyl-4-oxo-2-quinazolinyl)thio]acetic acid
  • Acetic acid, [(3,4-dihydro-6,7-dimethoxy-3-methyl-4-oxo-2-quinazolinyl)thio]-
  • Acetic acid, 2-[(3,4-dihydro-6,7-dimethoxy-3-methyl-4-oxo-2-quinazolinyl)thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.