CAS 886501-09-3

(3-chloro-2,4-difluorophenyl)methanol

Description:

(3-Chloro-2,4-difluorophenyl)methanol is an organic compound characterized by its phenolic structure, which includes a methanol group attached to a chlorinated and fluorinated aromatic ring. The presence of chlorine and fluorine atoms introduces significant electronegativity, influencing the compound's reactivity and polarity. This compound is likely to exhibit moderate solubility in polar solvents due to the hydroxyl (-OH) group, while the aromatic ring may contribute to hydrophobic interactions. The chlorinated and fluorinated substituents can enhance the compound's biological activity, making it of interest in pharmaceutical applications. Additionally, the specific arrangement of the substituents on the phenyl ring can affect its steric and electronic properties, potentially impacting its interactions with biological targets. Safety data sheets would typically indicate that it should be handled with care, as halogenated compounds can pose environmental and health risks. Overall, (3-chloro-2,4-difluorophenyl)methanol is a compound of interest in both synthetic chemistry and medicinal chemistry due to its unique structural features.

Formula: C₇H₅ClF₂O

InChI: InChI=1/C7H5ClF2O/c8-6-5(9)2-1-4(3-11)7(6)10/h1-2,11H,3H2

SMILES: c1cc(c(c(c1CO)F)Cl)F

Synonyms:

• 3-Chloro-2,4-difluorobenzyl alcohol
• Q1R Cg Bf Df

Benzenemethanol,3-chloro-2,4-difluoro-

CAS: 886501-09-3

Formula: C₇H₅ClF₂O

Purity: 98%

Molecular weight: 178.5638

Ref: IN-DA0048Y1

3-Chloro-2,4-difluorobenzyl alcohol

CAS: 886501-09-3

3-Chloro-2,4-difluorobenzyl alcohol

Formula: C₇H₅ClF₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 178.56g/mol

Ref: 54-PC5442

3-Chloro-2,4-difluorobenzyl alcohol

CAS: 886501-09-3

Formula: C₇H₅ClF₂O

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 178.56

Ref: 10-F342445