CymitQuimica logo

CAS 886501-12-8

:

2-chloro-4-piperidin-1-ylbenzaldehyde

Description:
2-Chloro-4-piperidin-1-ylbenzaldehyde is an organic compound characterized by its structure, which includes a benzaldehyde moiety substituted with a piperidine ring and a chlorine atom. The presence of the piperidine group contributes to its potential as a pharmacophore in medicinal chemistry, often influencing its biological activity. The chlorine atom introduces a halogen, which can enhance lipophilicity and alter the compound's reactivity. This compound typically appears as a solid or liquid, depending on the specific conditions, and is soluble in organic solvents. Its molecular structure allows for various interactions, making it of interest in the development of pharmaceuticals, particularly in the fields of neurochemistry and drug design. The compound's reactivity may involve electrophilic aromatic substitution due to the electron-withdrawing nature of the chlorine atom, and it may also participate in nucleophilic reactions due to the aldehyde functional group. Overall, 2-chloro-4-piperidin-1-ylbenzaldehyde is a versatile compound with potential applications in various chemical and biological contexts.
Formula:C12H14ClNO
InChI:InChI=1/C12H14ClNO/c13-12-8-11(5-4-10(12)9-15)14-6-2-1-3-7-14/h4-5,8-9H,1-3,6-7H2
SMILES:C1CCN(CC1)c1ccc(C=O)c(c1)Cl
Synonyms:
  • 2-Chloro-4-(piperidin-1-yl)benzaldehyde
  • Benzaldehyde, 2-Chloro-4-(1-Piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.