CAS 886501-28-6

4-Chloro-3-(1-piperidinyl)benzoic acid

Description:

4-Chloro-3-(1-piperidinyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a chlorine atom and a piperidine ring. The presence of the chlorine atom at the 4-position and the piperidinyl group at the 3-position contributes to its unique chemical properties, including potential biological activity. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water. It may exhibit acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification or amidation. The piperidine ring can also engage in hydrogen bonding and contribute to the compound's interaction with biological targets. Due to its structural features, 4-Chloro-3-(1-piperidinyl)benzoic acid may be of interest in medicinal chemistry and drug development, particularly in the design of pharmaceuticals targeting specific receptors or enzymes.

Formula: C₁₂H₁₄ClNO₂

InChI: InChI=1S/C12H14ClNO2/c13-10-5-4-9(12(15)16)8-11(10)14-6-2-1-3-7-14/h4-5,8H,1-3,6-7H2,(H,15,16)

InChI key: InChIKey=AWYXXFCRDASAPP-UHFFFAOYSA-N

SMILES: ClC=1C(=CC(C(O)=O)=CC1)N2CCCCC2

Synonyms:

• Benzoic acid, 4-chloro-3-(1-piperidinyl)-
• 4-Chloro-3-(1-piperidinyl)benzoic acid