CAS 886501-46-8

4-Chloro-3-(4-morpholinyl)benzoic acid

Description:

4-Chloro-3-(4-morpholinyl)benzoic acid is an organic compound characterized by its benzoic acid structure, which includes a chloro substituent and a morpholine group. The presence of the chloro group at the 4-position of the benzene ring and the morpholine moiety at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its potential for various applications in pharmaceuticals and agrochemicals. The morpholine ring enhances its ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the carboxylic acid functional group allows for potential reactivity in esterification or amidation reactions. Its molecular structure suggests that it may exhibit specific biological activities, which would require further investigation through pharmacological studies. As with many chemical substances, safety data should be consulted to understand its handling and toxicity profiles.

Formula: C₁₁H₁₂ClNO₃

InChI: InChI=1S/C11H12ClNO3/c12-9-2-1-8(11(14)15)7-10(9)13-3-5-16-6-4-13/h1-2,7H,3-6H2,(H,14,15)

InChI key: InChIKey=DHQJUAWXZZYMHR-UHFFFAOYSA-N

SMILES: ClC=1C(=CC(C(O)=O)=CC1)N2CCOCC2

Synonyms:

• 4-Chloro-3-(4-morpholinyl)benzoic acid
• Benzoic acid, 4-chloro-3-(4-morpholinyl)-
• 4-CHLORO-3-MORPHOLIN-4-YL-BENZOIC ACID

4-Chloro-3-(morpholin-4-yl)benzoic acid

CAS: 886501-46-8

Versatile small molecule scaffold

Formula: C₁₁H₁₂ClNO₃

Purity: Min. 95%

Molecular weight: 241.67 g/mol

Ref: 3D-LKB50146