CAS 886501-52-6

4-Methyl-3-(4-morpholinyl)benzoic acid

Description:

4-Methyl-3-(4-morpholinyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a methyl group and a morpholine ring. The presence of the morpholine group contributes to its potential as a pharmacophore in medicinal chemistry, often enhancing solubility and bioavailability. This compound typically exhibits properties such as moderate solubility in polar solvents and may show varying degrees of acidity due to the carboxylic acid functional group. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug development. Additionally, the compound may display specific reactivity patterns typical of benzoic acids, including esterification and amidation. Safety and handling considerations should be taken into account, as with many organic compounds, including proper storage and disposal methods. Overall, 4-Methyl-3-(4-morpholinyl)benzoic acid represents a versatile structure in organic synthesis and pharmaceutical applications.

Formula: C₁₂H₁₅NO₃

InChI: InChI=1S/C12H15NO3/c1-9-2-3-10(12(14)15)8-11(9)13-4-6-16-7-5-13/h2-3,8H,4-7H2,1H3,(H,14,15)

InChI key: InChIKey=XIRXLFWLLYSPOR-UHFFFAOYSA-N

SMILES: CC=1C(=CC(C(O)=O)=CC1)N2CCOCC2

Synonyms:

• Benzoic acid, 4-methyl-3-(4-morpholinyl)-
• 4-Methyl-3-(4-morpholinyl)benzoic acid

4-Methyl-3-morpholinobenzoic acid

CAS: 886501-52-6

Versatile small molecule scaffold

Formula: C₁₂H₁₅NO₃

Purity: Min. 95%

Molecular weight: 221.25 g/mol

Ref: 3D-LKB50152