CAS 886501-68-4

2-(2-Furanyl)-4-methyl-5-thiazolecarboxylic acid

Description:

2-(2-Furanyl)-4-methyl-5-thiazolecarboxylic acid is an organic compound characterized by its unique structural features, which include a furan ring and a thiazole moiety. The presence of these heterocyclic rings contributes to its potential biological activity and chemical reactivity. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. The thiazole ring is known for its role in various biological systems, while the furan ring can enhance the compound's lipophilicity. Additionally, the compound may undergo various chemical reactions, such as esterification or amidation, due to the reactive carboxylic acid group. Overall, 2-(2-Furanyl)-4-methyl-5-thiazolecarboxylic acid represents a versatile scaffold for further chemical modifications and investigations in medicinal chemistry.

Formula: C₉H₇NO₃S

InChI: InChI=1S/C9H7NO3S/c1-5-7(9(11)12)14-8(10-5)6-3-2-4-13-6/h2-4H,1H3,(H,11,12)

InChI key: InChIKey=DMIJUNDFNWUZNL-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1SC(=NC1C)C2=CC=CO2

Synonyms:

• 2-(Furan-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid
• 2-(2-Furanyl)-4-methyl-5-thiazolecarboxylic acid
• 5-Thiazolecarboxylic acid, 2-(2-furanyl)-4-methyl-