CymitQuimica logo

CAS 886501-95-7

:

4-Oxo-2H-1,3-benzoxazine-3(4H)-pentanoic acid

Description:
4-Oxo-2H-1,3-benzoxazine-3(4H)-pentanoic acid, identified by its CAS number 886501-95-7, is a chemical compound that features a benzoxazine ring structure, which is characterized by a fused benzene and oxazine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The presence of the pentanoic acid moiety suggests that it may have acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The oxo group contributes to its reactivity, potentially enabling it to act as a precursor in synthetic organic chemistry. Additionally, compounds of this class may exhibit biological activity, making them of interest in pharmaceutical research. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, 4-Oxo-2H-1,3-benzoxazine-3(4H)-pentanoic acid represents a versatile structure with potential applications in various fields of chemistry and materials science.
Formula:C13H15NO4
InChI:InChI=1S/C13H15NO4/c15-12(16)7-3-4-8-14-9-18-11-6-2-1-5-10(11)13(14)17/h1-2,5-6H,3-4,7-9H2,(H,15,16)
InChI key:InChIKey=SZCGVRDHMGBDDC-UHFFFAOYSA-N
SMILES:O=C1C=2C(OCN1CCCCC(O)=O)=CC=CC2
Synonyms:
  • 4-Oxo-2H-1,3-benzoxazine-3(4H)-pentanoic acid
  • 2H-1,3-Benzoxazine-3(4H)-pentanoic acid, 4-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.