CymitQuimica logo

CAS 886502-06-3

:

6-Cyclopropyl-3-methyl-1-(1-methylethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:
6-Cyclopropyl-3-methyl-1-(1-methylethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a chemical compound characterized by its complex bicyclic structure, which includes a pyrazolo[3,4-b]pyridine core. This compound features a cyclopropyl group and an isopropyl substituent, contributing to its unique steric and electronic properties. The presence of a carboxylic acid functional group indicates potential acidity and reactivity, allowing for interactions with various biological targets. The compound's structure suggests it may exhibit interesting pharmacological activities, potentially acting as a modulator in various biochemical pathways. Its molecular weight, solubility, and stability would depend on the specific conditions, such as pH and solvent. Additionally, the compound's CAS number, 886502-06-3, allows for easy identification in chemical databases, facilitating research and development in medicinal chemistry and related fields. Overall, this compound's unique structural features and functional groups make it a subject of interest for further studies in drug discovery and development.
Formula:C14H17N3O2
InChI:InChI=1S/C14H17N3O2/c1-7(2)17-13-12(8(3)16-17)10(14(18)19)6-11(15-13)9-4-5-9/h6-7,9H,4-5H2,1-3H3,(H,18,19)
InChI key:InChIKey=MASWFOBXAQJQRZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(N(C(C)C)N=C2C)=NC(=C1)C3CC3
Synonyms:
  • 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 6-cyclopropyl-3-methyl-1-(1-methylethyl)-
  • 6-Cyclopropyl-3-methyl-1-(1-methylethyl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.