CAS 886502-15-4

4-Oxo-2H-1,3-benzoxazine-3(4H)-acetic acid

Description:

4-Oxo-2H-1,3-benzoxazine-3(4H)-acetic acid, with the CAS number 886502-15-4, is a heterocyclic organic compound characterized by its benzoxazine structure, which features a fused benzene and oxazine ring. This compound typically exhibits a range of functional groups, including a carboxylic acid group, contributing to its potential reactivity and solubility in polar solvents. The presence of the oxo group enhances its electrophilic character, making it suitable for various chemical reactions, including nucleophilic attacks. Its unique structure may impart specific biological activities, making it of interest in medicinal chemistry and drug development. Additionally, the compound's stability, melting point, and solubility can vary based on environmental conditions and the presence of other chemical entities. Overall, 4-Oxo-2H-1,3-benzoxazine-3(4H)-acetic acid represents a versatile scaffold for further chemical modifications and applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₀H₉NO₄

InChI: InChI=1S/C10H9NO4/c12-9(13)5-11-6-15-8-4-2-1-3-7(8)10(11)14/h1-4H,5-6H2,(H,12,13)

InChI key: InChIKey=UICVSYQTLLETGI-UHFFFAOYSA-N

SMILES: O=C1C=2C(OCN1CC(O)=O)=CC=CC2

(4-Oxo-4H-benzo[e][1,3]oxazin-3-yl)-acetic acid

CAS: 886502-15-4

Formula: C₁₀H₉NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 207.185

Ref: 10-F027659