CAS 886502-53-0

2-Hydroxy-5-[(2-oxo-1-piperidinyl)methyl]benzoic acid

Description:

2-Hydroxy-5-[(2-oxo-1-piperidinyl)methyl]benzoic acid, identified by its CAS number 886502-53-0, is a chemical compound that features a benzoic acid core substituted with a hydroxyl group and a piperidine-derived moiety. This compound exhibits characteristics typical of both aromatic carboxylic acids and piperidine derivatives, which may influence its solubility, reactivity, and biological activity. The presence of the hydroxyl group enhances its potential for hydrogen bonding, which can affect its solubility in polar solvents. The piperidine ring contributes to its structural complexity and may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the ketone functionality in the piperidine ring can participate in various chemical reactions, potentially allowing for further derivatization. Overall, this compound's unique structure suggests potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require empirical investigation.

Formula: C₁₃H₁₅NO₄

InChI: InChI=1S/C13H15NO4/c15-11-5-4-9(7-10(11)13(17)18)8-14-6-2-1-3-12(14)16/h4-5,7,15H,1-3,6,8H2,(H,17,18)

InChI key: InChIKey=QLHYKMPWEDNUEI-UHFFFAOYSA-N

SMILES: C(C1=CC(C(O)=O)=C(O)C=C1)N2C(=O)CCCC2

Synonyms:

• Benzoic acid, 2-hydroxy-5-[(2-oxo-1-piperidinyl)methyl]-
• 2-Hydroxy-5-[(2-oxo-1-piperidinyl)methyl]benzoic acid