CymitQuimica logo

CAS 886502-91-6

:

1-Butyl-6-cyclopropyl-3-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:
1-Butyl-6-cyclopropyl-3-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyridine core. This compound features a butyl group and a cyclopropyl group, contributing to its unique physical and chemical properties. It is likely to exhibit moderate solubility in organic solvents due to its hydrophobic alkyl chains, while the carboxylic acid functional group may impart some degree of polarity and potential for hydrogen bonding. The presence of the pyrazole ring suggests potential biological activity, as many pyrazole derivatives are known for their pharmacological properties. The compound may also participate in various chemical reactions typical of carboxylic acids, such as esterification or amidation. Its specific applications and biological activities would depend on further research and characterization, including studies on its interaction with biological targets or its role in synthetic chemistry. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry and drug development.
Formula:C15H19N3O2
InChI:InChI=1S/C15H19N3O2/c1-3-4-7-18-14-13(9(2)17-18)11(15(19)20)8-12(16-14)10-5-6-10/h8,10H,3-7H2,1-2H3,(H,19,20)
InChI key:InChIKey=WPXOUFWTYGVFPW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(N(CCCC)N=C2C)=NC(=C1)C3CC3
Synonyms:
  • 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1-butyl-6-cyclopropyl-3-methyl-
  • 1-Butyl-6-cyclopropyl-3-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.