CAS 886502-92-7
:2-[4-(Trifluoromethoxy)phenyl]pyrrolidine
Description:
2-[4-(Trifluoromethoxy)phenyl]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a phenyl group substituted with a trifluoromethoxy group. The presence of the trifluoromethoxy group significantly influences its chemical properties, imparting high lipophilicity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components that can interact with biological targets. Additionally, the trifluoromethoxy group can enhance the compound's metabolic stability and bioavailability. As with many fluorinated compounds, it may also exhibit unique reactivity patterns and solubility characteristics. Safety and handling precautions should be observed, as fluorinated compounds can pose environmental and health risks. Overall, 2-[4-(Trifluoromethoxy)phenyl]pyrrolidine represents a compound of interest in various chemical and pharmaceutical research contexts.
Formula:C11H12F3NO
InChI:InChI=1S/C11H12F3NO/c12-11(13,14)16-9-5-3-8(4-6-9)10-2-1-7-15-10/h3-6,10,15H,1-2,7H2
InChI key:InChIKey=XCKVCAOSVNOPOM-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC=C(C=C1)C2CCCN2
Synonyms:- Pyrrolidine, 2-[4-(trifluoromethoxy)phenyl]-
- 2-[4-(Trifluoromethoxy)phenyl]pyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
