CAS 886502-99-4

2,3,4,5,6-Pentafluorophenyl 2-bromobenzenesulfonate

Description:

2,3,4,5,6-Pentafluorophenyl 2-bromobenzenesulfonate is a chemical compound characterized by its complex structure, which includes a pentafluorophenyl group and a bromobenzenesulfonate moiety. This compound is notable for its high fluorine content, which imparts unique electronic and steric properties, making it useful in various chemical reactions, particularly in the field of organic synthesis. The presence of the bromine atom enhances its reactivity, allowing it to participate in nucleophilic substitution reactions. Additionally, the sulfonate group contributes to its solubility in polar solvents, facilitating its use in diverse applications, including as a reagent in the synthesis of more complex organic molecules. The compound is typically handled with care due to the potential hazards associated with its components, particularly the fluorinated groups, which can exhibit toxicity and environmental persistence. Overall, 2,3,4,5,6-Pentafluorophenyl 2-bromobenzenesulfonate serves as a valuable tool in synthetic organic chemistry, particularly in the development of fluorinated compounds.

Formula: C₁₂H₄BrF₅O₃S

InChI: InChI=1S/C12H4BrF5O3S/c13-5-3-1-2-4-6(5)22(19,20)21-12-10(17)8(15)7(14)9(16)11(12)18/h1-4H

InChI key: InChIKey=SDGIQWYMQYSLJQ-UHFFFAOYSA-N

SMILES: O(S(=O)(=O)C1=C(Br)C=CC=C1)C2=C(F)C(F)=C(F)C(F)=C2F

Synonyms:

• 2,3,4,5,6-Pentafluorophenyl 2-bromobenzenesulfonate
• Pentafluorophenyl 2-bromobenzenesulfonate
• Benzenesulfonic acid, 2-bromo-, 2,3,4,5,6-pentafluorophenyl ester
• Benzenesulfonic acid, 2-bromo-, pentafluorophenyl ester
• Perfluorophenyl 2-bromobenzenesulfonate
• PENTAFLUOROPHENYL 2-BROMO-BENZENESULFONATE

Pentafluorophenyl 2-bromo-benzenesulfonate

CAS: 886502-99-4

Formula: C₁₂H₄BrF₅O₃S

Purity: 98.0%

Molecular weight: 403.12

Ref: 10-F024739