CAS 886503-39-5

3,6-Dimethyl-1-propyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

3,6-Dimethyl-1-propyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features two methyl groups at the 3 and 6 positions and a propyl group at the 1 position of the pyrazole ring, contributing to its unique chemical properties. The presence of a carboxylic acid functional group at the 4 position enhances its acidity and reactivity, making it a potential candidate for various chemical reactions and applications. The molecular structure suggests that it may exhibit biological activity, possibly interacting with specific receptors or enzymes due to its heterocyclic nature. Additionally, the compound's solubility and stability can be influenced by the substituents on the rings, which may affect its pharmacokinetic properties if explored for medicinal chemistry. Overall, 3,6-Dimethyl-1-propyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid represents a complex and interesting molecule within the realm of organic chemistry.

Formula: C₁₂H₁₅N₃O₂

InChI: InChI=1S/C12H15N3O2/c1-4-5-15-11-10(8(3)14-15)9(12(16)17)6-7(2)13-11/h6H,4-5H2,1-3H3,(H,16,17)

InChI key: InChIKey=ALWQIHWLNLCNJZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(N(CCC)N=C2C)=NC(C)=C1

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 3,6-dimethyl-1-propyl-
• 3,6-Dimethyl-1-propyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid