CAS 886503-49-7

5-[[2-(Phenylmethyl)phenoxy]methyl]-2-furancarboxylic acid

Description:

5-[[2-(Phenylmethyl)phenoxy]methyl]-2-furancarboxylic acid, with the CAS number 886503-49-7, is an organic compound characterized by its unique structure that includes a furan ring and a phenylmethyl group. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the phenoxy and phenylmethyl substituents suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as esterification or amidation. Its furan moiety may also impart some degree of aromaticity and stability. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it potentially useful in organic synthesis or as a building block in pharmaceuticals. Additionally, the structural complexity may allow for interactions with biological systems, warranting further investigation into its potential applications in medicinal chemistry or material science. Overall, this compound represents a fascinating example of modern organic chemistry with potential implications in various fields.

Formula: C₁₉H₁₆O₄

InChI: InChI=1S/C19H16O4/c20-19(21)18-11-10-16(23-18)13-22-17-9-5-4-8-15(17)12-14-6-2-1-3-7-14/h1-11H,12-13H2,(H,20,21)

InChI key: InChIKey=RLTLLVPPTQCUEW-UHFFFAOYSA-N

SMILES: O(CC=1OC(C(O)=O)=CC1)C2=C(CC3=CC=CC=C3)C=CC=C2

Synonyms:

• 5-[[2-(Phenylmethyl)phenoxy]methyl]-2-furancarboxylic acid
• 2-Furancarboxylic acid, 5-[[2-(phenylmethyl)phenoxy]methyl]-