CAS 886503-54-4

7-(2-Naphthalenyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

Description:

7-(2-Naphthalenyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a heterocyclic compound characterized by its unique structure, which includes a pyrazolo-pyrimidine core fused with a naphthalene moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse reactivity due to the presence of functional groups. The carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can enhance solubility in polar solvents. Additionally, the naphthalene ring may impart hydrophobic characteristics, influencing its interaction with biological systems. This compound is of interest in medicinal chemistry, particularly for its potential biological activities, which may include anti-inflammatory or anticancer properties. Its specific interactions and efficacy would depend on further studies, including pharmacokinetics and mechanism of action. Overall, 7-(2-Naphthalenyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid represents a promising scaffold for drug development and research in various chemical and biological applications.

Formula: C₁₇H₁₁N₃O₂

InChI: InChI=1S/C17H11N3O2/c21-17(22)14-10-16-18-8-7-15(20(16)19-14)13-6-5-11-3-1-2-4-12(11)9-13/h1-10H,(H,21,22)

InChI key: InChIKey=FPZNSROFTSLECQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NN2C(=CC=NC2=C1)C3=CC4=C(C=C3)C=CC=C4

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 7-(2-naphthalenyl)-
• 7-(2-Naphthalenyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

7-(Naphthalen-2-yl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

CAS: 886503-54-4

Versatile small molecule scaffold

Formula: C₁₇H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 289.29 g/mol

Ref: 3D-LKB50354