CAS 886503-59-9

6-(4-Chlorophenyl)-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

6-(4-Chlorophenyl)-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyridine framework. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a 4-chlorophenyl group enhances its lipophilicity and may influence its biological activity. The dimethyl substitutions on the pyrazole ring can affect the compound's steric and electronic properties, potentially impacting its interactions with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, including anti-inflammatory or anticancer activities. Its specific interactions and efficacy would depend on its ability to bind to target proteins or enzymes, which can be influenced by its structural characteristics. As with many heterocyclic compounds, the synthesis and characterization of this substance are crucial for understanding its reactivity and potential applications in drug development.

Formula: C₁₅H₁₂ClN₃O₂

InChI: InChI=1S/C15H12ClN3O2/c1-8-13-11(15(20)21)7-12(17-14(13)19(2)18-8)9-3-5-10(16)6-4-9/h3-7H,1-2H3,(H,20,21)

InChI key: InChIKey=RMLVJZYHWNWIBO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=NC(=C1)C3=CC=C(Cl)C=C3)N(C)N=C2C

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 6-(4-chlorophenyl)-1,3-dimethyl-
• 6-(4-Chlorophenyl)-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid