
CAS 886503-60-2
:3-[3-(Trifluoromethyl)phenyl]thiophene
Description:
3-[3-(Trifluoromethyl)phenyl]thiophene is an organic compound characterized by its unique structure, which includes a thiophene ring substituted with a trifluoromethyl group and a phenyl group. The presence of the trifluoromethyl group enhances the compound's electron-withdrawing properties, which can significantly influence its reactivity and stability. This compound typically exhibits good thermal stability and may possess interesting electronic properties, making it potentially useful in organic electronics, such as in the development of organic semiconductors or photovoltaic materials. Additionally, the thiophene moiety contributes to its aromatic character, which can affect its solubility and interaction with other chemical species. The compound's CAS number, 886503-60-2, allows for easy identification and reference in chemical databases. Overall, 3-[3-(Trifluoromethyl)phenyl]thiophene is of interest in various fields, including materials science and medicinal chemistry, due to its distinctive structural features and potential applications.
Formula:C11H7F3S
InChI:InChI=1S/C11H7F3S/c12-11(13,14)10-3-1-2-8(6-10)9-4-5-15-7-9/h1-7H
InChI key:InChIKey=WZCAVDBDBUCKQN-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1)C=2C=CSC2
Synonyms:- 3-[3-(Trifluoromethyl)phenyl]thiophene
- Thiophene, 3-[3-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.