
CAS 886503-73-7
:6-Bromo-3-(2-hydrazinyl-4-thiazolyl)-2,8-dimethylimidazo[1,2-a]pyridine
Description:
6-Bromo-3-(2-hydrazinyl-4-thiazolyl)-2,8-dimethylimidazo[1,2-a]pyridine is a complex organic compound characterized by its unique structural features, which include a bromine atom, a hydrazine moiety, and a thiazole ring. This compound belongs to the imidazopyridine class, which is known for its diverse biological activities. The presence of the bromine substituent can enhance the compound's reactivity and influence its pharmacological properties. The hydrazine group is often associated with potential antitumor and antimicrobial activities, while the thiazole ring contributes to the compound's overall stability and reactivity. Additionally, the dimethyl groups on the imidazo ring can affect the compound's solubility and lipophilicity, which are critical factors in drug design and development. Overall, this compound's intricate structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents targeting various diseases. However, further studies are necessary to fully elucidate its biological properties and mechanisms of action.
Formula:C12H12BrN5S
InChI:InChI=1S/C12H12BrN5S/c1-6-3-8(13)4-18-10(7(2)15-11(6)18)9-5-19-12(16-9)17-14/h3-5H,14H2,1-2H3,(H,16,17)
InChI key:InChIKey=GPRFQJMAAUKSRL-UHFFFAOYSA-N
SMILES:CC1=C(N2C(=N1)C(C)=CC(Br)=C2)C=3NC(=NN)SC3
Synonyms:- 2(3H)-Thiazolone, 4-(6-bromo-2,8-dimethylimidazo[1,2-a]pyridin-3-yl)-, hydrazone
- Imidazo[1,2-a]pyridine, 6-bromo-3-(2-hydrazinyl-4-thiazolyl)-2,8-dimethyl-
- 6-Bromo-3-(2-hydrazinyl-4-thiazolyl)-2,8-dimethylimidazo[1,2-a]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.