
CAS 886503-83-9
:8-Bromo-3-(2-hydrazinyl-4-thiazolyl)-2,6-dimethylimidazo[1,2-a]pyridine
Description:
8-Bromo-3-(2-hydrazinyl-4-thiazolyl)-2,6-dimethylimidazo[1,2-a]pyridine is a chemical compound characterized by its complex structure, which includes a bromine atom, a hydrazine group, and a thiazole moiety. This compound belongs to the imidazopyridine class, which is known for its diverse biological activities. The presence of the bromine substituent often enhances the compound's reactivity and potential for forming interactions with biological targets. The hydrazine group can participate in various chemical reactions, including hydrazone formation, which is significant in medicinal chemistry. The thiazole ring contributes to the compound's overall stability and may influence its pharmacological properties. Additionally, the dimethyl groups on the imidazopyridine core can affect the compound's lipophilicity and solubility, impacting its bioavailability. Overall, this compound's unique structural features suggest potential applications in drug development, particularly in areas targeting specific biological pathways or diseases. However, further studies are necessary to fully elucidate its properties and potential therapeutic uses.
Formula:C12H12BrN5S
InChI:InChI=1S/C12H12BrN5S/c1-6-3-8(13)11-15-7(2)10(18(11)4-6)9-5-19-12(16-9)17-14/h3-5H,14H2,1-2H3,(H,16,17)
InChI key:InChIKey=PXQHXJCYXKXKIK-UHFFFAOYSA-N
SMILES:CC1=C(N2C(=N1)C(Br)=CC(C)=C2)C=3NC(=NN)SC3
Synonyms:- 8-Bromo-3-(2-hydrazinyl-4-thiazolyl)-2,6-dimethylimidazo[1,2-a]pyridine
- 2(3H)-Thiazolone, 4-(8-bromo-2,6-dimethylimidazo[1,2-a]pyridin-3-yl)-, hydrazone
- Imidazo[1,2-a]pyridine, 8-bromo-3-(2-hydrazinyl-4-thiazolyl)-2,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.