
CAS 886503-88-4
:6-Bromo-3-(2-hydrazinyl-4-thiazolyl)-2-methylimidazo[1,2-a]pyridine
Description:
6-Bromo-3-(2-hydrazinyl-4-thiazolyl)-2-methylimidazo[1,2-a]pyridine is a heterocyclic compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core substituted with a bromine atom and a hydrazinyl-thiazole moiety. This compound typically exhibits properties associated with heterocycles, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the bromine atom may enhance its reactivity and influence its interaction with biological targets. The hydrazinyl group can participate in various chemical reactions, including hydrazone formation, which is significant in drug development. Additionally, the thiazole ring contributes to the compound's overall stability and may enhance its pharmacological properties. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential applications.
Formula:C11H10BrN5S
InChI:InChI=1S/C11H10BrN5S/c1-6-10(8-5-18-11(15-8)16-13)17-4-7(12)2-3-9(17)14-6/h2-5H,13H2,1H3,(H,15,16)
InChI key:InChIKey=MTWFOBVBIVWLSD-UHFFFAOYSA-N
SMILES:CC1=C(N2C(=N1)C=CC(Br)=C2)C=3NC(=NN)SC3
Synonyms:- Imidazo[1,2-a]pyridine, 6-bromo-3-(2-hydrazinyl-4-thiazolyl)-2-methyl-
- 2(3H)-Thiazolone, 4-(6-bromo-2-methylimidazo[1,2-a]pyridin-3-yl)-, hydrazone
- 6-Bromo-3-(2-hydrazinyl-4-thiazolyl)-2-methylimidazo[1,2-a]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.