CymitQuimica logo

CAS 886504-12-7

:

3-(2-Hydrazinyl-4-thiazolyl)-2,8-dimethylimidazo[1,2-a]pyridine

Description:
3-(2-Hydrazinyl-4-thiazolyl)-2,8-dimethylimidazo[1,2-a]pyridine, identified by its CAS number 886504-12-7, is a heterocyclic compound featuring a complex structure that includes imidazole and thiazole rings. This compound is characterized by the presence of hydrazine and methyl groups, which contribute to its reactivity and potential biological activity. Typically, compounds of this nature may exhibit properties such as antimicrobial, antitumor, or anti-inflammatory activities, making them of interest in medicinal chemistry. The thiazole and imidazole moieties can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, the presence of multiple functional groups allows for diverse interactions with biological targets. The compound's solubility, stability, and reactivity can vary based on its environment, influencing its potential applications in pharmaceuticals or agrochemicals. As with many heterocycles, understanding its structure-activity relationship is crucial for exploring its utility in drug development or other chemical applications.
Formula:C12H13N5S
InChI:InChI=1S/C12H13N5S/c1-7-4-3-5-17-10(8(2)14-11(7)17)9-6-18-12(15-9)16-13/h3-6H,13H2,1-2H3,(H,15,16)
InChI key:InChIKey=PSYKJSPEQABHSI-UHFFFAOYSA-N
SMILES:CC1=C(N2C(=N1)C(C)=CC=C2)C=3NC(=NN)SC3
Synonyms:
  • 3-(2-Hydrazinyl-4-thiazolyl)-2,8-dimethylimidazo[1,2-a]pyridine
  • Imidazo[1,2-a]pyridine, 3-(2-hydrazinyl-4-thiazolyl)-2,8-dimethyl-
  • 2(3H)-Thiazolone, 4-(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)-, hydrazone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.