CAS 886504-23-0
:N,N-Diethyl-4-(1-piperazinyl)benzenesulfonamide
Description:
N,N-Diethyl-4-(1-piperazinyl)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a benzene ring substituted with a piperazine moiety and two ethyl groups attached to the nitrogen atoms, contributing to its lipophilicity and potential biological activity. The presence of the sulfonamide group suggests that it may interact with biological systems, possibly inhibiting certain enzymes or acting as a pharmacological agent. Its structure indicates that it may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. The compound's CAS number, 886504-23-0, allows for precise identification in chemical databases and literature. Due to its unique structure, it may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through empirical studies.
Formula:C14H23N3O2S
InChI:InChI=1S/C14H23N3O2S/c1-3-17(4-2)20(18,19)14-7-5-13(6-8-14)16-11-9-15-10-12-16/h5-8,15H,3-4,9-12H2,1-2H3
InChI key:InChIKey=QTZDCDPLNMBSCA-UHFFFAOYSA-N
SMILES:S(N(CC)CC)(=O)(=O)C1=CC=C(C=C1)N2CCNCC2
Synonyms:- Benzenesulfonamide, N,N-diethyl-4-(1-piperazinyl)-
- N,N-Diethyl-4-(1-piperazinyl)benzenesulfonamide
- N,N-DIETHYL-4-PIPERAZIN-1-YL-BENZENESULFONAMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
