
CAS 886504-40-1
:4-(2-Fluoro-4-methoxyphenyl)-2-hydrazinylthiazole
Description:
4-(2-Fluoro-4-methoxyphenyl)-2-hydrazinylthiazole, identified by its CAS number 886504-40-1, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound is characterized by the presence of a hydrazine functional group, which is known for its reactivity and potential applications in various chemical reactions, including as a reducing agent. The presence of a fluoro and methoxy substituent on the phenyl ring contributes to its unique electronic properties, potentially influencing its biological activity and solubility. The thiazole moiety is often associated with pharmacological properties, making this compound of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H10FN3OS
InChI:InChI=1S/C10H10FN3OS/c1-15-6-2-3-7(8(11)4-6)9-5-16-10(13-9)14-12/h2-5H,12H2,1H3,(H,13,14)
InChI key:InChIKey=RKCSQIKOCGIBIG-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(OC)=C1)C=2NC(=NN)SC2
Synonyms:- 4-(2-Fluoro-4-methoxyphenyl)-2-hydrazinylthiazole
- 2(3H)-Thiazolone, 4-(2-fluoro-4-methoxyphenyl)-, hydrazone
- Thiazole, 4-(2-fluoro-4-methoxyphenyl)-2-hydrazinyl-
- [4-(2-Fluoro-4-methoxy-phenyl)-thiazol-2-yl]-hydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.