
CAS 886504-96-7
:4-[2-Fluoro-3-(trifluoromethyl)phenyl]-2-hydrazinylthiazole
Description:
4-[2-Fluoro-3-(trifluoromethyl)phenyl]-2-hydrazinylthiazole is a chemical compound characterized by its unique structural features, which include a thiazole ring, a hydrazine functional group, and a phenyl ring substituted with both a fluorine and a trifluoromethyl group. The presence of the thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. Additionally, the fluorine atom can affect the electronic properties of the molecule, potentially enhancing its stability and bioavailability. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its CAS number, 886504-96-7, allows for easy identification and retrieval of information related to its synthesis, applications, and safety data. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C10H7F4N3S
InChI:InChI=1S/C10H7F4N3S/c11-8-5(7-4-18-9(16-7)17-15)2-1-3-6(8)10(12,13)14/h1-4H,15H2,(H,16,17)
InChI key:InChIKey=OVHRPVSIBUDXSB-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1C(F)(F)F)C=2NC(=NN)SC2
Synonyms:- Thiazole, 4-[2-fluoro-3-(trifluoromethyl)phenyl]-2-hydrazinyl-
- 2(3H)-Thiazolone, 4-[2-fluoro-3-(trifluoromethyl)phenyl]-, hydrazone
- 4-[2-Fluoro-3-(trifluoromethyl)phenyl]-2-hydrazinylthiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.