CymitQuimica logo

CAS 886505-00-6

:

4-[2-Fluoro-4-(trifluoromethyl)phenyl]-2-hydrazinylthiazole

Description:
4-[2-Fluoro-4-(trifluoromethyl)phenyl]-2-hydrazinylthiazole is a chemical compound characterized by its unique structural features, which include a thiazole ring and a hydrazine functional group. The presence of a fluorine atom and a trifluoromethyl group on the phenyl ring contributes to its distinct electronic properties and potential reactivity. This compound is likely to exhibit significant lipophilicity due to the fluorinated groups, which can influence its solubility and bioavailability in various environments. Additionally, the thiazole moiety is known for its biological activity, often being involved in medicinal chemistry as a scaffold for drug development. The hydrazine group may also impart specific reactivity, making it a candidate for further chemical transformations. Overall, this compound's unique combination of functional groups suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities and safety profiles would require further investigation.
Formula:C10H7F4N3S
InChI:InChI=1S/C10H7F4N3S/c11-7-3-5(10(12,13)14)1-2-6(7)8-4-18-9(16-8)17-15/h1-4H,15H2,(H,16,17)
InChI key:InChIKey=BMANOGZKKGZUHJ-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(C(F)(F)F)=C1)C=2NC(=NN)SC2
Synonyms:
  • 4-[2-Fluoro-4-(trifluoromethyl)phenyl]-2-hydrazinylthiazole
  • 2(3H)-Thiazolone, 4-[2-fluoro-4-(trifluoromethyl)phenyl]-, hydrazone
  • Thiazole, 4-[2-fluoro-4-(trifluoromethyl)phenyl]-2-hydrazinyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.