CAS 886505-14-2
:1-Ethyl-N-(1-methylethyl)-1H-imidazole-2-methanamine
Description:
1-Ethyl-N-(1-methylethyl)-1H-imidazole-2-methanamine, with the CAS number 886505-14-2, is a chemical compound that belongs to the class of imidazole derivatives. This substance features an imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of an ethyl group and a branched isopropyl group contributes to its unique properties, potentially influencing its solubility and reactivity. Typically, imidazole derivatives exhibit biological activity, making them of interest in pharmaceutical research. The compound may possess basic properties due to the nitrogen atoms in the imidazole ring, which can participate in protonation and coordination with metal ions. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require experimental determination or literature references for precise values.
Formula:C9H17N3
InChI:InChI=1S/C9H17N3/c1-4-12-6-5-10-9(12)7-11-8(2)3/h5-6,8,11H,4,7H2,1-3H3
InChI key:InChIKey=WEWRAAGPPVSTBD-UHFFFAOYSA-N
SMILES:C(NC(C)C)C=1N(CC)C=CN1
Synonyms:- 1H-Imidazole-2-methanamine, 1-ethyl-N-(1-methylethyl)-
- 1-Ethyl-N-(1-methylethyl)-1H-imidazole-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.