CAS 886505-35-7

1,1-Dimethylethyl N-[2-(3-thienyl)phenyl]carbamate

Description:

1,1-Dimethylethyl N-[2-(3-thienyl)phenyl]carbamate, identified by its CAS number 886505-35-7, is an organic compound characterized by its carbamate functional group, which is derived from the reaction of a carbamic acid with an alcohol. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its reactivity and solubility. The presence of the thienyl and phenyl groups indicates that it may exhibit interesting electronic properties and could participate in various chemical interactions, making it of interest in fields such as medicinal chemistry or agrochemicals. The thienyl moiety, a five-membered aromatic ring containing sulfur, may impart unique biological activities or enhance the compound's affinity for specific targets. Additionally, the overall structure suggests potential applications in drug development or as a pesticide, depending on its biological activity. As with many organic compounds, its stability, solubility, and reactivity would be influenced by environmental conditions and the presence of other chemical species.

Formula: C₁₅H₁₇NO₂S

InChI: InChI=1S/C15H17NO2S/c1-15(2,3)18-14(17)16-13-7-5-4-6-12(13)11-8-9-19-10-11/h4-10H,1-3H3,(H,16,17)

InChI key: InChIKey=OFLACRFDYISVIV-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=C(C=CC=C1)C=2C=CSC2

Synonyms:

• Carbamic acid, N-[2-(3-thienyl)phenyl]-, 1,1-dimethylethyl ester
• Carbamic acid, [2-(3-thienyl)phenyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[2-(3-thienyl)phenyl]carbamate