CAS 886505-64-2
:1-Ethyl-N-(2-furanylmethyl)-1H-imidazole-2-methanamine
Description:
1-Ethyl-N-(2-furanylmethyl)-1H-imidazole-2-methanamine, with the CAS number 886505-64-2, is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features an ethyl group and a furanylmethyl substituent, contributing to its unique properties and potential biological activities. The presence of the furanyl group may impart specific reactivity and interactions, particularly in biological systems, as furan derivatives are known for their roles in various chemical reactions and as building blocks in organic synthesis. The imidazole moiety is often associated with biological significance, including roles in enzyme catalysis and as a component of many pharmaceuticals. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used, making it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C11H15N3O
InChI:InChI=1S/C11H15N3O/c1-2-14-6-5-13-11(14)9-12-8-10-4-3-7-15-10/h3-7,12H,2,8-9H2,1H3
InChI key:InChIKey=VYJICGDAGQVIIK-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CO1)C=2N(CC)C=CN2
Synonyms:- 1H-Imidazole-2-methanamine, 1-ethyl-N-(2-furanylmethyl)-
- 1-Ethyl-N-(2-furanylmethyl)-1H-imidazole-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.