CAS 886505-72-2

1-Butyl-N-ethyl-1H-imidazole-2-methanamine

Description:

1-Butyl-N-ethyl-1H-imidazole-2-methanamine, with the CAS number 886505-72-2, is an organic compound that belongs to the class of imidazole derivatives. This substance features a butyl group and an ethyl group attached to the nitrogen atoms of the imidazole ring, along with a methanamine functional group. Its structure suggests it may exhibit properties typical of both amines and imidazoles, such as potential basicity and nucleophilicity. The presence of the butyl and ethyl groups may influence its solubility, making it more hydrophobic compared to simpler amines. This compound could be of interest in various applications, including pharmaceuticals, agrochemicals, or as a ligand in coordination chemistry due to the presence of nitrogen atoms that can coordinate with metal ions. Additionally, the imidazole ring is known for its biological significance, often found in various biomolecules, which may suggest potential biological activity or interactions. However, specific data on its reactivity, stability, and toxicity would require further investigation.

Formula: C₁₀H₁₉N₃

InChI: InChI=1S/C10H19N3/c1-3-5-7-13-8-6-12-10(13)9-11-4-2/h6,8,11H,3-5,7,9H2,1-2H3

InChI key: InChIKey=UHZUEGQIKOQNEP-UHFFFAOYSA-N

SMILES: C(NCC)C=1N(CCCC)C=CN1

Synonyms:

• 1H-Imidazole-2-methanamine, 1-butyl-N-ethyl-
• 1-Butyl-N-ethyl-1H-imidazole-2-methanamine