
CAS 886505-87-9
:5-[2-(1-Hydroxycyclohexyl)ethynyl]-2-furancarboxylic acid
Description:
5-[2-(1-Hydroxycyclohexyl)ethynyl]-2-furancarboxylic acid, with the CAS number 886505-87-9, is a chemical compound characterized by its unique structure that includes a furan ring and an ethynyl group attached to a cyclohexyl moiety. This compound features a hydroxyl group, which contributes to its potential solubility in polar solvents and may influence its reactivity and biological activity. The presence of the furan ring suggests potential applications in organic synthesis and medicinal chemistry, as furan derivatives are often explored for their pharmacological properties. The ethynyl group can enhance the compound's reactivity, making it a candidate for further chemical modifications. Additionally, the carboxylic acid functional group may impart acidic properties, affecting its behavior in various chemical environments. Overall, this compound's structural features suggest potential utility in research and development, particularly in the fields of pharmaceuticals and materials science. However, specific applications and biological activities would require further investigation and characterization.
Formula:C13H14O4
InChI:InChI=1S/C13H14O4/c14-12(15)11-5-4-10(17-11)6-9-13(16)7-2-1-3-8-13/h4-5,16H,1-3,7-8H2,(H,14,15)
InChI key:InChIKey=GDCAEFZYGLXTPF-UHFFFAOYSA-N
SMILES:C(#CC1(O)CCCCC1)C=2OC(C(O)=O)=CC2
Synonyms:- 2-Furancarboxylic acid, 5-[2-(1-hydroxycyclohexyl)ethynyl]-
- 5-[2-(1-Hydroxycyclohexyl)ethynyl]-2-furancarboxylic acid
- 2-Furancarboxylic acid, 5-[(1-hydroxycyclohexyl)ethynyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.