CymitQuimica logo

CAS 886506-02-1

:

N-(2-Methoxyethyl)benzo[b]thiophene-2-methanamine

Description:
N-(2-Methoxyethyl)benzo[b]thiophene-2-methanamine is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core substituted with a methanamine group and a methoxyethyl side chain. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the thiophene ring, which can influence its reactivity and interaction with biological systems. The methoxyethyl group may enhance solubility in organic solvents and contribute to the compound's overall stability. As a result, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific characteristics, such as melting point, boiling point, solubility, and spectral properties, would require experimental determination or detailed literature references for precise values. Additionally, safety and handling information should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C12H15NOS
InChI:InChI=1S/C12H15NOS/c1-14-7-6-13-9-11-8-10-4-2-3-5-12(10)15-11/h2-5,8,13H,6-7,9H2,1H3
InChI key:InChIKey=DLSVHICTLXDSJC-UHFFFAOYSA-N
SMILES:C(NCCOC)C1=CC=2C(S1)=CC=CC2
Synonyms:
  • N-(2-Methoxyethyl)benzo[b]thiophene-2-methanamine
  • Benzo[b]thiophene-2-methanamine, N-(2-methoxyethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.