CymitQuimica logo

CAS 886506-05-4

:

N-(4-Fluorophenyl)-3-pyrrolidinamine

Description:
N-(4-Fluorophenyl)-3-pyrrolidinamine, identified by its CAS number 886506-05-4, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a fluorophenyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. N-(4-Fluorophenyl)-3-pyrrolidinamine may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as modifications to the pyrrolidine and phenyl moieties can lead to variations in potency and selectivity for biological targets. Additionally, its stability and solubility in various solvents can be influenced by the presence of the fluorine substituent. Overall, this compound represents a class of organic molecules that can be explored for various applications in drug discovery and development.
Formula:C10H13FN2
InChI:InChI=1S/C10H13FN2/c11-8-1-3-9(4-2-8)13-10-5-6-12-7-10/h1-4,10,12-13H,5-7H2
InChI key:InChIKey=OGNLBWVIULUBBM-UHFFFAOYSA-N
SMILES:N(C1=CC=C(F)C=C1)C2CCNC2
Synonyms:
  • N-(4-Fluorophenyl)-3-pyrrolidinamine
  • 3-Pyrrolidinamine, N-(4-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.