CymitQuimica logo

CAS 886506-12-3

:

Ethyl [4,4′-bipiperidine]-1-carboxylate

Description:
Ethyl [4,4′-bipiperidine]-1-carboxylate is a chemical compound characterized by its unique structure, which includes a bipiperidine moiety and an ethyl ester functional group. This compound typically exhibits properties associated with both piperidine and carboxylate functionalities, such as moderate polarity and potential basicity due to the nitrogen atoms in the piperidine rings. It may be soluble in organic solvents like ethanol and dichloromethane, while its solubility in water could be limited due to the hydrophobic nature of the bipiperidine structure. Ethyl [4,4′-bipiperidine]-1-carboxylate may also demonstrate biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis often involves multi-step organic reactions, and it can serve as an intermediate in the preparation of various pharmaceuticals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H24N2O2
InChI:InChI=1S/C13H24N2O2/c1-2-17-13(16)15-9-5-12(6-10-15)11-3-7-14-8-4-11/h11-12,14H,2-10H2,1H3
InChI key:InChIKey=QUSZESQSWSUKQT-UHFFFAOYSA-N
SMILES:C(OCC)(=O)N1CCC(CC1)C2CCNCC2
Synonyms:
  • Ethyl [4,4′-bipiperidine]-1-carboxylate
  • [4,4′-Bipiperidine]-1-carboxylic acid, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.