CAS 886506-48-5
:N-(2-piperidin-2-ylethyl)acetamide
Description:
N-(2-piperidin-2-ylethyl)acetamide, identified by its CAS number 886506-48-5, is an organic compound characterized by its amide functional group and a piperidine ring. This substance features a piperidine moiety, which is a six-membered ring containing five carbon atoms and one nitrogen atom, contributing to its potential biological activity. The acetamide group indicates the presence of a carbonyl (C=O) linked to a nitrogen atom, which can influence its solubility and reactivity. Typically, compounds like this may exhibit properties such as moderate to high solubility in polar solvents due to the presence of the amide group. The piperidine ring can impart basic characteristics, making the compound potentially interact with biological systems, including receptors or enzymes. Such compounds are often explored in medicinal chemistry for their pharmacological properties, including analgesic or neuroactive effects. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C9H18N2O
InChI:InChI=1/C9H18N2O/c1-8(12)10-7-5-9-4-2-3-6-11-9/h9,11H,2-7H2,1H3,(H,10,12)
SMILES:CC(=NCCC1CCCCN1)O
Synonyms:- Acetamide, N-[2-(2-piperidinyl)ethyl]-
- N-[2-(Piperidin-2-yl)ethyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
