CAS 886506-54-3

N-(3-Fluoro-4-methylphenyl)-4-piperidinamine

Description:

N-(3-Fluoro-4-methylphenyl)-4-piperidinamine, identified by its CAS number 886506-54-3, is a chemical compound that features a piperidine ring substituted with an amine group and a phenyl moiety. The presence of a fluorine atom at the 3-position and a methyl group at the 4-position of the phenyl ring contributes to its unique chemical properties. This compound is typically characterized by its moderate polarity, which can influence its solubility in various solvents. The piperidine structure imparts basicity to the molecule, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the specific arrangement of substituents can affect its biological activity, making it of interest in medicinal chemistry for potential therapeutic applications. The compound's stability, reactivity, and interaction with biological targets can be further explored through various analytical techniques, including spectroscopy and chromatography. Overall, N-(3-Fluoro-4-methylphenyl)-4-piperidinamine represents a class of compounds that may exhibit significant pharmacological properties.

Formula: C₁₂H₁₇FN₂

InChI: InChI=1S/C12H17FN2/c1-9-2-3-11(8-12(9)13)15-10-4-6-14-7-5-10/h2-3,8,10,14-15H,4-7H2,1H3

InChI key: InChIKey=MGILUDSYWPVAIT-UHFFFAOYSA-N

SMILES: N(C1=CC(F)=C(C)C=C1)C2CCNCC2

Synonyms:

• 4-Piperidinamine, N-(3-fluoro-4-methylphenyl)-
• N-(3-Fluoro-4-methylphenyl)-4-piperidinamine

(3-Fluoro-4-methyl-phenyl)-piperidin-4-yl-amine

CAS: 886506-54-3

Formula: C₁₂H₁₇FN₂

Color and Shape: Solid

Molecular weight: 208.28

Ref: 10-F032061