CymitQuimica logo

CAS 886506-57-6

:

N-Cycloheptyl-4-piperidinamine

Description:
N-Cycloheptyl-4-piperidinamine is a chemical compound characterized by its piperidine structure, which features a six-membered ring containing one nitrogen atom. The presence of a cycloheptyl group at the nitrogen position contributes to its unique properties, including potential steric effects and hydrophobic characteristics. This compound may exhibit basic properties due to the amine functional group, allowing it to participate in various chemical reactions, including protonation and nucleophilic attacks. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders or other therapeutic areas. The compound's solubility, stability, and reactivity can be influenced by the cycloheptyl substituent, which may affect its interaction with biological targets. As with many amines, it may also engage in hydrogen bonding, impacting its biological activity and pharmacokinetics. Overall, N-Cycloheptyl-4-piperidinamine represents a compound of interest for further research and development in chemical and pharmaceutical sciences.
Formula:C12H24N2
InChI:InChI=1S/C12H24N2/c1-2-4-6-11(5-3-1)14-12-7-9-13-10-8-12/h11-14H,1-10H2
InChI key:InChIKey=WVWVYEJJBYWAOQ-UHFFFAOYSA-N
SMILES:N(C1CCCCCC1)C2CCNCC2
Synonyms:
  • N-Cycloheptyl-4-piperidinamine
  • 4-Piperidinamine, N-cycloheptyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.