CAS 886507-05-7

N-(3-Piperidinylmethyl)propanamide

Description:

N-(3-Piperidinylmethyl)propanamide is a chemical compound characterized by its amide functional group, which is derived from propanoic acid and features a piperidine ring. This compound typically exhibits properties associated with amides, such as moderate polarity and the ability to engage in hydrogen bonding, which can influence its solubility in polar solvents. The presence of the piperidine moiety contributes to its potential biological activity, as piperidine derivatives are often found in various pharmaceuticals and bioactive compounds. The molecular structure suggests that it may have applications in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Additionally, its CAS number, 886507-05-7, allows for easy identification and retrieval of information regarding its synthesis, safety data, and potential uses in research and industry. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₁₈N₂O

InChI: InChI=1S/C9H18N2O/c1-2-9(12)11-7-8-4-3-5-10-6-8/h8,10H,2-7H2,1H3,(H,11,12)

InChI key: InChIKey=ABUOKCYGDYMIBL-UHFFFAOYSA-N

SMILES: C(NC(CC)=O)C1CCCNC1

Synonyms:

• Propanamide, N-(3-piperidinylmethyl)-
• N-(3-Piperidinylmethyl)propanamide