CymitQuimica logo

CAS 886507-40-0

:

4-(2,8-Dimethylimidazo[1,2-a]pyridin-3-yl)-2-thiazolamine

Description:
4-(2,8-Dimethylimidazo[1,2-a]pyridin-3-yl)-2-thiazolamine is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine moiety and a thiazolamine group. This compound is notable for its potential biological activity, often studied in the context of medicinal chemistry and pharmacology. The presence of the dimethyl groups on the imidazo ring may influence its lipophilicity and biological interactions. The thiazole ring contributes to its heterocyclic nature, which can enhance its reactivity and binding properties in biological systems. This compound may exhibit various properties such as solubility in organic solvents, stability under specific conditions, and potential interactions with biological targets, making it of interest in drug development and research. Its CAS number, 886507-40-0, allows for precise identification in chemical databases, facilitating further studies on its synthesis, characterization, and applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H12N4S
InChI:InChI=1S/C12H12N4S/c1-7-4-3-5-16-10(8(2)14-11(7)16)9-6-17-12(13)15-9/h3-6H,1-2H3,(H2,13,15)
InChI key:InChIKey=GTHLSHLKHHVBRC-UHFFFAOYSA-N
SMILES:CC1=C(N2C(=N1)C(C)=CC=C2)C=3N=C(N)SC3
Synonyms:
  • 4-(2,8-Dimethylimidazo[1,2-a]pyridin-3-yl)-2-thiazolamine
  • 2-Thiazolamine, 4-(2,8-dimethylimidazo[1,2-a]pyridin-3-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.