CAS 886508-53-8
:5-(aminomethyl)-1,3-dimethyl-1,3-dihydro-2H-benzimidazol-2-one
Description:
5-(Aminomethyl)-1,3-dimethyl-1,3-dihydro-2H-benzimidazol-2-one, with the CAS number 886508-53-8, is a chemical compound characterized by its unique structure that includes a benzimidazole core. This compound features two methyl groups at the 1 and 3 positions, contributing to its dimethyl substitution pattern, and an aminomethyl group at the 5 position, which enhances its potential for biological activity. The presence of the dihydro form indicates that it contains a saturated ring structure, which may influence its reactivity and stability. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including possible applications in treating various diseases. Its solubility, melting point, and specific reactivity would depend on the surrounding conditions and the presence of functional groups. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any risks associated with its use.
Formula:C10H13N3O
InChI:InChI=1/C10H13N3O/c1-12-8-4-3-7(6-11)5-9(8)13(2)10(12)14/h3-5H,6,11H2,1-2H3
SMILES:Cn1c2ccc(cc2n(C)c1=O)CN
Synonyms:- 2H-Benzimidazol-2-one, 5-(aminomethyl)-1,3-dihydro-1,3-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(Aminomethyl)-1,3-dimethyl-1,3-dihydro-2h-benzimidazol-2-one
CAS:Formula:C10H13N3OMolecular weight:191.2297
