CAS 88653-00-3

2-Propenoic acid, 3-(dimethylamino)-3-phenyl-, ethyl ester

Description:

2-Propenoic acid, 3-(dimethylamino)-3-phenyl-, ethyl ester, commonly referred to as a methacrylate derivative, is an organic compound characterized by its acrylate structure, which includes a propenoic acid backbone with a dimethylamino and phenyl substituent. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the vinyl group, making it suitable for polymerization processes. It exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many esters. The dimethylamino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and polymerization. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Safety data should be consulted, as it may pose health risks upon exposure, necessitating appropriate handling and storage measures. Overall, its unique structure and reactivity profile make it valuable in the synthesis of polymers and other chemical applications.

Formula: C₁₃H₁₇NO₂

InChI: InChI=1S/C13H17NO2/c1-4-16-13(15)10-12(14(2)3)11-8-6-5-7-9-11/h5-10H,4H2,1-3H3

InChI key: InChIKey=YEYOCDJGWJBOAZ-UHFFFAOYSA-N

SMILES: C(=CC(OCC)=O)(N(C)C)C1=CC=CC=C1

Synonyms:

• 2-Propenoic acid, 3-(dimethylamino)-3-phenyl-, ethyl ester

2-Propenoic acid, 3-(dimethylamino)-3-phenyl-, ethyl ester

CAS: 88653-00-3

Formula: C₁₃H₁₇NO₂

Molecular weight: 219.2796

Ref: IN-DA0048ZI