
CAS 88653-15-0
:1-Amino-4-[(3-methoxyphenyl)amino]-9,10-anthracenedione
Description:
1-Amino-4-[(3-methoxyphenyl)amino]-9,10-anthracenedione, with the CAS number 88653-15-0, is an organic compound characterized by its anthraquinone structure, which consists of a central anthracene core with various functional groups. This compound features an amino group and a methoxy-substituted phenyl group, contributing to its potential biological activity and solubility properties. It typically exhibits a deep color, characteristic of many anthraquinone derivatives, and may display fluorescence under certain conditions. The presence of the amino and methoxy groups can influence its reactivity, making it a candidate for various applications in organic synthesis, dye production, and potentially in medicinal chemistry due to its structural similarity to other biologically active compounds. Additionally, its properties may include moderate to high stability under standard conditions, but it may be sensitive to light and heat, which can affect its performance in practical applications. Overall, this compound's unique structure and functional groups make it of interest in both research and industrial contexts.
Formula:C21H16N2O3
InChI:InChI=1S/C21H16N2O3/c1-26-13-6-4-5-12(11-13)23-17-10-9-16(22)18-19(17)21(25)15-8-3-2-7-14(15)20(18)24/h2-11,23H,22H2,1H3
InChI key:InChIKey=UNQABTJUSVYLOV-UHFFFAOYSA-N
SMILES:N(C1=C2C(C(=O)C=3C(C2=O)=CC=CC3)=C(N)C=C1)C4=CC(OC)=CC=C4
Synonyms:- 1-Amino-4-[(3-methoxyphenyl)amino]-9,10-anthracenedione
- 9,10-Anthracenedione, 1-amino-4-[(3-methoxyphenyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Amino-4-((3-methoxyphenyl)amino)anthracene-9,10-dione
CAS:Formula:C21H16N2O3Molecular weight:344.3633
