CAS 88658-02-0
:2-{4-[(3E)-3-(2-chloro-9H-thioxanthen-9-ylidene)propyl]piperazin-1-yl}ethyl acetate
Description:
2-{4-[(3E)-3-(2-chloro-9H-thioxanthen-9-ylidene)propyl]piperazin-1-yl}ethyl acetate, with the CAS number 88658-02-0, is a synthetic organic compound characterized by its complex structure, which includes a piperazine moiety and a thioxanthene derivative. This compound typically exhibits properties associated with both piperazine and thioxanthene classes, potentially influencing its pharmacological activity. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to the presence of both hydrophobic and polar functional groups. The chloro substituent may impart specific reactivity and influence the compound's biological interactions. As a derivative of thioxanthene, it may exhibit properties relevant to neuropharmacology, possibly acting as an antipsychotic or anxiolytic agent. However, detailed studies would be necessary to elucidate its specific biological activities, mechanisms of action, and potential therapeutic applications. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated components.
Formula:C24H27ClN2O2S
InChI:InChI=1/C24H27ClN2O2S/c1-18(28)29-16-15-27-13-11-26(12-14-27)10-4-6-20-21-5-2-3-7-23(21)30-24-9-8-19(25)17-22(20)24/h2-3,5-9,17H,4,10-16H2,1H3/b20-6+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
