CAS 886615-33-4

4-Chloro-N-1-piperidinylbutanamide

Description:

4-Chloro-N-1-piperidinylbutanamide, identified by its CAS number 886615-33-4, is a chemical compound characterized by its structural features, which include a piperidine ring and a butanamide moiety. The presence of a chlorine atom at the fourth position of the butanamide chain contributes to its unique reactivity and potential biological activity. This compound is typically classified as an amide, which is known for its stability and ability to participate in various chemical reactions, including nucleophilic substitutions and hydrolysis. The piperidine ring, a six-membered saturated nitrogen-containing heterocycle, imparts certain pharmacological properties, making this compound of interest in medicinal chemistry. Its solubility and stability in various solvents can vary, influencing its application in research and development. Additionally, the compound may exhibit specific interactions with biological targets, which could be explored for therapeutic purposes. As with many chemical substances, safety data and handling precautions should be considered when working with 4-Chloro-N-1-piperidinylbutanamide in laboratory settings.

Formula: C₉H₁₇ClN₂O

InChI: InChI=1S/C9H17ClN2O/c10-6-4-5-9(13)11-12-7-2-1-3-8-12/h1-8H2,(H,11,13)

InChI key: InChIKey=PXCNDTOCSICTDL-UHFFFAOYSA-N

SMILES: N(C(CCCCl)=O)N1CCCCC1

Synonyms:

• 4-Chloro-N-(piperidin-1-yl)butyramide
• Butanamide, 4-chloro-N-1-piperidinyl-
• 4-Chloro-N-1-piperidinylbutanamide