CAS 886620-76-4
:3-(4-fluorophenyl)-1-(4-methoxyphenyl)propan-1-one
Description:
3-(4-Fluorophenyl)-1-(4-methoxyphenyl)propan-1-one, identified by its CAS number 886620-76-4, is an organic compound characterized by its ketone functional group and a propanone backbone. This compound features a propan-1-one structure with two aromatic substituents: a para-fluorophenyl group and a para-methoxyphenyl group. The presence of the fluorine atom introduces unique electronic properties, potentially enhancing the compound's reactivity and influencing its interactions in biological systems. The methoxy group contributes to the compound's lipophilicity, which may affect its solubility and permeability in various environments. This compound may be of interest in medicinal chemistry and material science due to its structural features, which could impart specific pharmacological activities or facilitate the development of novel materials. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through spectroscopic methods such as NMR and mass spectrometry.
Formula:C16H15FO2
InChI:InChI=1/C16H15FO2/c1-19-15-9-5-13(6-10-15)16(18)11-4-12-2-7-14(17)8-3-12/h2-3,5-10H,4,11H2,1H3
SMILES:COc1ccc(cc1)C(=O)CCc1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
