CAS 88664-09-9
:14-Deoxycoleon U
Description:
14-Deoxycoleon U, with the CAS number 88664-09-9, is a naturally occurring chemical compound classified as a terpenoid. It is primarily derived from certain plant species, particularly those in the family Euphorbiaceae. This compound is characterized by its unique molecular structure, which includes a series of carbon rings and functional groups that contribute to its biological activity. 14-Deoxycoleon U has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and anticancer activities. Its mechanism of action is still under investigation, but it is believed to interact with various biological pathways. Additionally, the compound's solubility and stability can vary depending on environmental conditions, which may influence its efficacy in therapeutic applications. As research continues, 14-Deoxycoleon U may offer insights into the development of new drugs and treatments, particularly in the realm of natural product chemistry.
Formula:C20H26O4
InChI:InChI=1S/C20H26O4/c1-10(2)11-9-12-13(16(23)14(11)21)20(5)8-6-7-19(3,4)18(20)17(24)15(12)22/h9-10,21,23-24H,6-8H2,1-5H3/t20-/m1/s1
InChI key:InChIKey=QDFALZMZLBCVCD-HXUWFJFHSA-N
SMILES:C[C@@]12C=3C(C(=O)C(O)=C1C(C)(C)CCC2)=CC(C(C)C)=C(O)C3O
Synonyms:- 6-Hydroxysalvinolone
- 11-Hydroxymontbretol
- 9(1H)-Phenanthrenone, 2,3,4,4a-tetrahydro-5,6,10-trihydroxy-1,1,4a-trimethyl-7-(1-methylethyl)-, (4aR)-
- (4aR)-2,3,4,4a-Tetrahydro-5,6,10-trihydroxy-1,1,4a-trimethyl-7-(1-methylethyl)-9(1H)-phenanthrenone
- 9(1H)-Phenanthrenone, 2,3,4,4a-tetrahydro-5,6,10-trihydroxy-1,1,4a-trimethyl-7-(1-methylethyl)-, (R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
14-Deoxycoleon U
CAS:14-Deoxycoleon U combats termites, wood fungi, and Gram-positive bacteria like S. aureus, S. epidermidis, E. faecalis, and M. luteus.Formula:C20H26O4Purity:98%Color and Shape:SolidMolecular weight:330.42414-Deoxycoleon U
CAS:Formula:C20H26O4Purity:95%~99%Color and Shape:Yellow powderMolecular weight:330.42414-Deoxycoleon U
CAS:Controlled Product14-Deoxycoleon U is a chemical compound that has been shown to induce apoptosis in HL-60 cells. It also induces autophagy, which is a process of cellular self-eating. 14-Deoxycoleon U does not bind to the cell membrane and does not interfere with the action of other chemotherapeutic agents. This chemical compound has cytotoxic effects on cancer cells, including staphylococcus and k562 cells. The cytotoxic effect of 14-Deoxycoleon U is due to its pro-apoptotic protein; it has no effect on healthy cells because they do not have this protein. 14-Deoxycoleon U can be used as a dietary supplement for cancer treatment.
Formula:C20H26O4Purity:Min. 95%Molecular weight:330.4 g/mol



