CAS 88666-89-1
:Benzene, 1,3,5-triethynyl-, homopolymer
Description:
Benzene, 1,3,5-triethynyl-, homopolymer, identified by CAS number 88666-89-1, is a synthetic polymer derived from the polymerization of triethynylbenzene monomers. This compound exhibits a rigid, aromatic structure due to the presence of benzene rings, which contribute to its thermal stability and mechanical strength. The ethynyl groups enhance the polymer's reactivity, allowing for further functionalization and cross-linking, which can improve its properties for specific applications. Typically, this homopolymer is characterized by its high glass transition temperature, low solubility in common solvents, and excellent resistance to heat and chemical degradation. These attributes make it suitable for use in advanced materials, coatings, and composites, particularly in environments requiring durability and stability. Additionally, the unique structure of the polymer can lead to interesting optical properties, making it a candidate for applications in electronics and photonics. Overall, benzene, 1,3,5-triethynyl-, homopolymer is a versatile material with potential in various high-performance applications.
Formula:(C12H6)x
InChI:InChI=1S/C12H6/c1-4-10-7-11(5-2)9-12(6-3)8-10/h1-3,7-9H
InChI key:InChIKey=ZDRMMTYSQSIGRY-UHFFFAOYSA-N
SMILES:C(#C)C1=CC(C#C)=CC(C#C)=C1
Synonyms:- Benzene, 1,3,5-triethynyl-, homopolymer
- 1,3,5-Triethynylbenzene homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
